C18H25NO — CID 89196939
(3E)-3-[(Z)-but-2-enylidene]-1-butyl-2-methylidene-4a,5,6,8a-tetrahydroquinolin-4-one (PubChem CID 89196939) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (3E)-3-[(Z)-but-2-enylidene]-1-butyl-2-methylidene-4a,5,6,8a-tetrahydroquinolin-4-one.
| Compound Name | (3E)-3-[(Z)-but-2-enylidene]-1-butyl-2-methylidene-4a,5,6,8a-tetrahydroquinolin-4-one |
|---|---|
| PubChem CID | 89196939 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (3E)-3-[(Z)-but-2-enylidene]-1-butyl-2-methylidene-4a,5,6,8a-tetrahydroquinolin-4-one |
| SMILES | C=C1/C(=C\C=C/C)C(=O)C2CCC=CC2N1CCCC |
| InChI | InChI=1S/C18H25NO/c1-4-6-10-15-14(3)19(13-7-5-2)17-12-9-8-11-16(17)18(15)20/h4,6,9-10,12,16-17H,3,5,7-8,11,13H2,1-2H3/b6-4-,15-10+ |
| InChIKey | TXOMQUFPSKFKKK-SAVCMJOPSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|