C20H9F5O5 — CID 89197096
5-[1,1,1,3,3-pentafluoro-2-(3-methylidene-1-oxo-2-benzofuran-5-yl)propan-2-yl]-2-benzofuran-1,3-dione (PubChem CID 89197096) has the molecular formula C20H9F5O5 and a molecular weight of 424.28 g/mol. Its IUPAC name is 5-[1,1,1,3,3-pentafluoro-2-(3-methylidene-1-oxo-2-benzofuran-5-yl)propan-2-yl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[1,1,1,3,3-pentafluoro-2-(3-methylidene-1-oxo-2-benzofuran-5-yl)propan-2-yl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 89197096 |
| Molecular Formula | C20H9F5O5 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 5-[1,1,1,3,3-pentafluoro-2-(3-methylidene-1-oxo-2-benzofuran-5-yl)propan-2-yl]-2-benzofuran-1,3-dione |
| SMILES | C=C1OC(=O)c2ccc(C(c3ccc4c(c3)C(=O)OC4=O)(C(F)F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C20H9F5O5/c1-8-13-6-9(2-4-11(13)15(26)29-8)19(18(21)22,20(23,24)25)10-3-5-12-14(7-10)17(28)30-16(12)27/h2-7,18H,1H2 |
| InChIKey | CEIHNAGJOACVAD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|