About (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine
(5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine (PubChem CID 89197632) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine.
Molecular Properties
| Compound Name | (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine |
| PubChem CID | 89197632 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine |
| SMILES | CNC1C2CC3C[C@H]1CN(C3)C2 |
| InChI | InChI=1S/C10H18N2/c1-11-10-8-2-7-3-9(10)6-12(4-7)5-8/h7-11H,2-6H2,1H3/t7?,8-,9?,10?/m0/s1 |
| InChIKey | HRWUUUZHCJVUDS-QKTHJCGZSA-N |
| XLogP | 0.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine?
The IUPAC name of (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine (CID 89197632) is (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine.
What is the SMILES notation for (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine?
The canonical SMILES for (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine is CNC1C2CC3C[C@H]1CN(C3)C2.
What is the InChIKey of (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine?
The InChIKey is HRWUUUZHCJVUDS-QKTHJCGZSA-N. The full InChI is InChI=1S/C10H18N2/c1-11-10-8-2-7-3-9(10)6-12(4-7)5-8/h7-11H,2-6H2,1H3/t7?,8-,9?,10?/m0/s1.
What are the key properties of (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine?
(5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine has a molecular weight of 166.27 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-N-methyl-1-azatricyclo[3.3.1.13,7]decan-4-amine is sourced from PubChem (CID 89197632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).