C10H17N — CID 89197862
4-methyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine (PubChem CID 89197862) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 4-methyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine.
| Compound Name | 4-methyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine |
|---|---|
| PubChem CID | 89197862 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4-methyl-2,3,4,6,7,9a-hexahydro-1H-quinolizine |
| SMILES | CC1CCCC2C=CCCN12 |
| InChI | InChI=1S/C10H17N/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2,6,9-10H,3-5,7-8H2,1H3 |
| InChIKey | JTLGMTXDVDOXKA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|