C7H8Cl2 — CID 89197889
(3Z,5E)-2,6-dichlorohepta-1,3,5-triene (PubChem CID 89197889) has the molecular formula C7H8Cl2 and a molecular weight of 163.05 g/mol. Its IUPAC name is (3Z,5E)-2,6-dichlorohepta-1,3,5-triene.
| Compound Name | (3Z,5E)-2,6-dichlorohepta-1,3,5-triene |
|---|---|
| PubChem CID | 89197889 |
| Molecular Formula | C7H8Cl2 |
| Molecular Weight | 163.05 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | (3Z,5E)-2,6-dichlorohepta-1,3,5-triene |
| SMILES | C=C(Cl)/C=C\C=C(/C)Cl |
| InChI | InChI=1S/C7H8Cl2/c1-6(8)4-3-5-7(2)9/h3-5H,1H2,2H3/b4-3-,7-5+ |
| InChIKey | FIDUHAPVNXNPQM-QVXLNCAUSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.05 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|