C20H29N — CID 89198092
N-[(2S,4Z)-hepta-4,6-dien-2-yl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]cyclohexen-1-amine (PubChem CID 89198092) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is N-[(2S,4Z)-hepta-4,6-dien-2-yl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]cyclohexen-1-amine.
| Compound Name | N-[(2S,4Z)-hepta-4,6-dien-2-yl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]cyclohexen-1-amine |
|---|---|
| PubChem CID | 89198092 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-[(2S,4Z)-hepta-4,6-dien-2-yl]-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]cyclohexen-1-amine |
| SMILES | C=C/C=C\C[C@H](C)N(C1=CCCCC1)C(/C=C\C=C)=C/C |
| InChI | InChI=1S/C20H29N/c1-5-8-11-14-18(4)21(19(7-3)15-9-6-2)20-16-12-10-13-17-20/h5-9,11,15-16,18H,1-2,10,12-14,17H2,3-4H3/b11-8-,15-9-,19-7+/t18-/m0/s1 |
| InChIKey | NLHAYOYRCAXEJV-PJSYKGJUSA-N |
| XLogP | 5.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|