About (4-ethyl-2-oxooxan-4-yl) acetate
(4-ethyl-2-oxooxan-4-yl) acetate (PubChem CID 89198151) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is (4-ethyl-2-oxooxan-4-yl) acetate.
Molecular Properties
| Compound Name | (4-ethyl-2-oxooxan-4-yl) acetate |
| PubChem CID | 89198151 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (4-ethyl-2-oxooxan-4-yl) acetate |
| SMILES | CCC1(OC(C)=O)CCOC(=O)C1 |
| InChI | InChI=1S/C9H14O4/c1-3-9(13-7(2)10)4-5-12-8(11)6-9/h3-6H2,1-2H3 |
| InChIKey | NVOBKAUKGOPEFD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-ethyl-2-oxooxan-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-2-oxooxan-4-yl) acetate?
The IUPAC name of (4-ethyl-2-oxooxan-4-yl) acetate (CID 89198151) is (4-ethyl-2-oxooxan-4-yl) acetate.
What is the SMILES notation for (4-ethyl-2-oxooxan-4-yl) acetate?
The canonical SMILES for (4-ethyl-2-oxooxan-4-yl) acetate is CCC1(OC(C)=O)CCOC(=O)C1.
What is the InChIKey of (4-ethyl-2-oxooxan-4-yl) acetate?
The InChIKey is NVOBKAUKGOPEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-3-9(13-7(2)10)4-5-12-8(11)6-9/h3-6H2,1-2H3.
What are the key properties of (4-ethyl-2-oxooxan-4-yl) acetate?
(4-ethyl-2-oxooxan-4-yl) acetate has a molecular weight of 186.21 g/mol, XLogP of 1.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-2-oxooxan-4-yl) acetate is sourced from PubChem (CID 89198151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).