About 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole
2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole (PubChem CID 89198240) has the molecular formula C9H9FN2
and a molecular weight of 164.18 g/mol. Its IUPAC name is 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole.
Molecular Properties
| Compound Name | 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole |
| PubChem CID | 89198240 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole |
| SMILES | FC1=CCC(C2=NCC=N2)C=C1 |
| InChI | InChI=1S/C9H9FN2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1,3-5,7H,2,6H2 |
| InChIKey | NKDBNZMHELMPRX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole?
The IUPAC name of 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole (CID 89198240) is 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole.
What is the SMILES notation for 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole?
The canonical SMILES for 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole is FC1=CCC(C2=NCC=N2)C=C1.
What is the InChIKey of 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole?
The InChIKey is NKDBNZMHELMPRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1,3-5,7H,2,6H2.
What are the key properties of 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole?
2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole has a molecular weight of 164.18 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorocyclohexa-2,4-dien-1-yl)-4H-imidazole is sourced from PubChem (CID 89198240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).