C27H39BO2 — CID 89198295
2-[(Z)-1-[1-ethyl-3-ethynyl-1-(3-methylbutyl)-3a,7a-dihydroinden-2-yl]prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 89198295) has the molecular formula C27H39BO2 and a molecular weight of 406.42 g/mol. Its IUPAC name is 2-[(Z)-1-[1-ethyl-3-ethynyl-1-(3-methylbutyl)-3a,7a-dihydroinden-2-yl]prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z)-1-[1-ethyl-3-ethynyl-1-(3-methylbutyl)-3a,7a-dihydroinden-2-yl]prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 89198295 |
| Molecular Formula | C27H39BO2 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | 2-[(Z)-1-[1-ethyl-3-ethynyl-1-(3-methylbutyl)-3a,7a-dihydroinden-2-yl]prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C#CC1=C(/C=C(\C)B2OC(C)(C)C(C)(C)O2)C(CC)(CCC(C)C)C2C=CC=CC12 |
| InChI | InChI=1S/C27H39BO2/c1-10-21-22-14-12-13-15-23(22)27(11-2,17-16-19(3)4)24(21)18-20(5)28-29-25(6,7)26(8,9)30-28/h1,12-15,18-19,22-23H,11,16-17H2,2-9H3/b20-18+ |
| InChIKey | CJLGPEDJWCULEK-CZIZESTLSA-N |
| XLogP | 6.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|