C7H12N2O — CID 89198794
(1Z,3Z)-1-methoxyhexa-1,3,5-triene-1,2-diamine (PubChem CID 89198794) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (1Z,3Z)-1-methoxyhexa-1,3,5-triene-1,2-diamine.
| Compound Name | (1Z,3Z)-1-methoxyhexa-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 89198794 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (1Z,3Z)-1-methoxyhexa-1,3,5-triene-1,2-diamine |
| SMILES | C=C/C=C\C(N)=C(/N)OC |
| InChI | InChI=1S/C7H12N2O/c1-3-4-5-6(8)7(9)10-2/h3-5H,1,8-9H2,2H3/b5-4-,7-6- |
| InChIKey | BPRXFXDIRVOLKB-RZSVFLSASA-N |
| XLogP | 0.46 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|