C16H30F5N — CID 89198964
10,10,11,11,11-pentafluoro-N,2,2,4,4-pentamethylundecan-1-amine (PubChem CID 89198964) has the molecular formula C16H30F5N and a molecular weight of 331.41 g/mol. Its IUPAC name is 10,10,11,11,11-pentafluoro-N,2,2,4,4-pentamethylundecan-1-amine.
| Compound Name | 10,10,11,11,11-pentafluoro-N,2,2,4,4-pentamethylundecan-1-amine |
|---|---|
| PubChem CID | 89198964 |
| Molecular Formula | C16H30F5N |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 10,10,11,11,11-pentafluoro-N,2,2,4,4-pentamethylundecan-1-amine |
| SMILES | CNCC(C)(C)CC(C)(C)CCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H30F5N/c1-13(2,11-14(3,4)12-22-5)9-7-6-8-10-15(17,18)16(19,20)21/h22H,6-12H2,1-5H3 |
| InChIKey | YVIAUCGELVSLAV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|