C16H20F6N2O2 — CID 89199023
tert-butyl N-[2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propyl]carbamate (PubChem CID 89199023) has the molecular formula C16H20F6N2O2 and a molecular weight of 386.34 g/mol. Its IUPAC name is tert-butyl N-[2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 89199023 |
| Molecular Formula | C16H20F6N2O2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | tert-butyl N-[2-amino-1-[3,5-bis(trifluoromethyl)phenyl]propyl]carbamate |
| SMILES | CC(N)C(NC(=O)OC(C)(C)C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F6N2O2/c1-8(23)12(24-13(25)26-14(2,3)4)9-5-10(15(17,18)19)7-11(6-9)16(20,21)22/h5-8,12H,23H2,1-4H3,(H,24,25) |
| InChIKey | BOZURLKCTYCWCB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |