About 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol
5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol (PubChem CID 89199090) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol.
Molecular Properties
| Compound Name | 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol |
| PubChem CID | 89199090 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol |
| SMILES | CC(C)(C)C1=CC2C=CNC2C=C1O |
| InChI | InChI=1S/C12H17NO/c1-12(2,3)9-6-8-4-5-13-10(8)7-11(9)14/h4-8,10,13-14H,1-3H3 |
| InChIKey | IUZNNWYCEUAQPE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol?
The IUPAC name of 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol (CID 89199090) is 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol.
What is the SMILES notation for 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol?
The canonical SMILES for 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol is CC(C)(C)C1=CC2C=CNC2C=C1O.
What is the InChIKey of 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol?
The InChIKey is IUZNNWYCEUAQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-12(2,3)9-6-8-4-5-13-10(8)7-11(9)14/h4-8,10,13-14H,1-3H3.
What are the key properties of 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol?
5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol has a molecular weight of 191.27 g/mol, XLogP of 2.52, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3a,7a-dihydro-1H-indol-6-ol is sourced from PubChem (CID 89199090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).