C27H21ClFN3O2 — CID 89199306
3-amino-4-[(1Z)-buta-1,3-dienyl]-9-[(2-chloroquinolin-3-yl)methyl]-6-ethyl-7-fluoropyrano[3,4-b]indol-1-one (PubChem CID 89199306) has the molecular formula C27H21ClFN3O2 and a molecular weight of 473.94 g/mol. Its IUPAC name is 3-amino-4-[(1Z)-buta-1,3-dienyl]-9-[(2-chloroquinolin-3-yl)methyl]-6-ethyl-7-fluoropyrano[3,4-b]indol-1-one.
| Compound Name | 3-amino-4-[(1Z)-buta-1,3-dienyl]-9-[(2-chloroquinolin-3-yl)methyl]-6-ethyl-7-fluoropyrano[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 89199306 |
| Molecular Formula | C27H21ClFN3O2 |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 3-amino-4-[(1Z)-buta-1,3-dienyl]-9-[(2-chloroquinolin-3-yl)methyl]-6-ethyl-7-fluoropyrano[3,4-b]indol-1-one |
| SMILES | C=C/C=C\c1c(N)oc(=O)c2c1c1cc(CC)c(F)cc1n2Cc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C27H21ClFN3O2/c1-3-5-9-18-23-19-12-15(4-2)20(29)13-22(19)32(24(23)27(33)34-26(18)30)14-17-11-16-8-6-7-10-21(16)31-25(17)28/h3,5-13H,1,4,14,30H2,2H3/b9-5- |
| InChIKey | KFMDRUGAEVRFIF-UITAMQMPSA-N |
| XLogP | 6.48 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|