C12H11N2O4S2- — CID 89199512
2-[(2-methoxy-3-methylbenzoyl)amino]-1,3-thiazole-5-sulfinate (PubChem CID 89199512) has the molecular formula C12H11N2O4S2- and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-[(2-methoxy-3-methylbenzoyl)amino]-1,3-thiazole-5-sulfinate.
| Compound Name | 2-[(2-methoxy-3-methylbenzoyl)amino]-1,3-thiazole-5-sulfinate |
|---|---|
| PubChem CID | 89199512 |
| Molecular Formula | C12H11N2O4S2- |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-[(2-methoxy-3-methylbenzoyl)amino]-1,3-thiazole-5-sulfinate |
| SMILES | COc1c(C)cccc1C(=O)Nc1ncc(S(=O)[O-])s1 |
| InChI | InChI=1S/C12H12N2O4S2/c1-7-4-3-5-8(10(7)18-2)11(15)14-12-13-6-9(19-12)20(16)17/h3-6H,1-2H3,(H,16,17)(H,13,14,15)/p-1 |
| InChIKey | CUVOCNFMMYOVFP-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|