About [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate
[4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate (PubChem CID 89199519) has the molecular formula C18H19N3O4S3
and a molecular weight of 437.57 g/mol. Its IUPAC name is [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate.
Molecular Properties
| Compound Name | [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate |
| PubChem CID | 89199519 |
| Molecular Formula | C18H19N3O4S3 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate |
| SMILES | C=C(NC(=O)c1ccc(OS(=O)(=O)C2CCC2)cc1)S/C(=C\N)c1nccs1 |
| InChI | InChI=1S/C18H19N3O4S3/c1-12(27-16(11-19)18-20-9-10-26-18)21-17(22)13-5-7-14(8-6-13)25-28(23,24)15-3-2-4-15/h5-11,15H,1-4,19H2,(H,21,22)/b16-11- |
| InChIKey | KLVLNWFUSKYAKG-WJDWOHSUSA-N |
| XLogP | 3.30 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate?
The IUPAC name of [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate (CID 89199519) is [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate.
What is the SMILES notation for [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate?
The canonical SMILES for [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate is C=C(NC(=O)c1ccc(OS(=O)(=O)C2CCC2)cc1)S/C(=C\N)c1nccs1.
What is the InChIKey of [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate?
The InChIKey is KLVLNWFUSKYAKG-WJDWOHSUSA-N. The full InChI is InChI=1S/C18H19N3O4S3/c1-12(27-16(11-19)18-20-9-10-26-18)21-17(22)13-5-7-14(8-6-13)25-28(23,24)15-3-2-4-15/h5-11,15H,1-4,19H2,(H,21,22)/b16-11-.
What are the key properties of [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate?
[4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate has a molecular weight of 437.57 g/mol, XLogP of 3.30, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-[(Z)-2-amino-1-(1,3-thiazol-2-yl)ethenyl]sulfanylethenylcarbamoyl]phenyl] cyclobutanesulfonate is sourced from PubChem (CID 89199519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).