C9H14BrN3 — CID 89199657
2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine (PubChem CID 89199657) has the molecular formula C9H14BrN3 and a molecular weight of 244.14 g/mol. Its IUPAC name is 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine.
| Compound Name | 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 89199657 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine |
| SMILES | CN(C)Cc1cc(N)cc(Br)c1N |
| InChI | InChI=1S/C9H14BrN3/c1-13(2)5-6-3-7(11)4-8(10)9(6)12/h3-4H,5,11-12H2,1-2H3 |
| InChIKey | ZGWXPQPZUVSINE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|