About 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine
2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine (PubChem CID 89199657) has the molecular formula C9H14BrN3
and a molecular weight of 244.14 g/mol. Its IUPAC name is 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine |
| PubChem CID | 89199657 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine |
| SMILES | CN(C)Cc1cc(N)cc(Br)c1N |
| InChI | InChI=1S/C9H14BrN3/c1-13(2)5-6-3-7(11)4-8(10)9(6)12/h3-4H,5,11-12H2,1-2H3 |
| InChIKey | ZGWXPQPZUVSINE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine?
The IUPAC name of 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine (CID 89199657) is 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine.
What is the SMILES notation for 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine?
The canonical SMILES for 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine is CN(C)Cc1cc(N)cc(Br)c1N.
What is the InChIKey of 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine?
The InChIKey is ZGWXPQPZUVSINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrN3/c1-13(2)5-6-3-7(11)4-8(10)9(6)12/h3-4H,5,11-12H2,1-2H3.
What are the key properties of 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine?
2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine has a molecular weight of 244.14 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-[(dimethylamino)methyl]benzene-1,4-diamine is sourced from PubChem (CID 89199657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).