C30H39BN6O4 — CID 89199696
CID 89199696 (PubChem CID 89199696) has the molecular formula C30H39BN6O4 and a molecular weight of 558.49 g/mol.
| Compound Name | CID 89199696 |
|---|---|
| PubChem CID | 89199696 |
| Molecular Formula | C30H39BN6O4 |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)NCC(=O)N2CCC(N3CCc4cc(OC)ccc4NC3=O)CC2)cc(CN2CCCCC2)c1N |
| InChI | InChI=1S/C30H39BN6O4/c1-41-24-5-6-26-20(16-24)7-14-37(30(40)34-26)23-8-12-36(13-9-23)27(38)18-33-29(39)21-15-22(28(32)25(31)17-21)19-35-10-3-2-4-11-35/h5-6,15-17,23H,2-4,7-14,18-19,32H2,1H3,(H,33,39)(H,34,40) |
| InChIKey | QBODMVUYURPPLC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|