C25H36FN3O — CID 89199855
N-[[(1R)-3,3-dimethyl-2-methylidenecyclohexyl]methyl]-3-(2-fluorophenyl)-2-pentyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 89199855) has the molecular formula C25H36FN3O and a molecular weight of 413.58 g/mol. Its IUPAC name is N-[[(1R)-3,3-dimethyl-2-methylidenecyclohexyl]methyl]-3-(2-fluorophenyl)-2-pentyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | N-[[(1R)-3,3-dimethyl-2-methylidenecyclohexyl]methyl]-3-(2-fluorophenyl)-2-pentyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 89199855 |
| Molecular Formula | C25H36FN3O |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | N-[[(1R)-3,3-dimethyl-2-methylidenecyclohexyl]methyl]-3-(2-fluorophenyl)-2-pentyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | C=C1[C@H](CNC(=O)C2=NN(CCCCC)C(c3ccccc3F)C2)CCCC1(C)C |
| InChI | InChI=1S/C25H36FN3O/c1-5-6-9-15-29-23(20-12-7-8-13-21(20)26)16-22(28-29)24(30)27-17-19-11-10-14-25(3,4)18(19)2/h7-8,12-13,19,23H,2,5-6,9-11,14-17H2,1,3-4H3,(H,27,30)/t19-,23?/m0/s1 |
| InChIKey | PGEQYYZDOYQTDT-HSTJUUNISA-N |
| XLogP | 5.62 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|