C27H36N3O3S+ — CID 89199903
N-[2-[(E)-2-[4-[bis(2-hydroxypropyl)amino]phenyl]ethenyl]-1,3,3-trimethylindol-1-ium-5-yl]-2-sulfanylacetamide (PubChem CID 89199903) has the molecular formula C27H36N3O3S+ and a molecular weight of 482.67 g/mol. Its IUPAC name is N-[2-[(E)-2-[4-[bis(2-hydroxypropyl)amino]phenyl]ethenyl]-1,3,3-trimethylindol-1-ium-5-yl]-2-sulfanylacetamide.
| Compound Name | N-[2-[(E)-2-[4-[bis(2-hydroxypropyl)amino]phenyl]ethenyl]-1,3,3-trimethylindol-1-ium-5-yl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 89199903 |
| Molecular Formula | C27H36N3O3S+ |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | N-[2-[(E)-2-[4-[bis(2-hydroxypropyl)amino]phenyl]ethenyl]-1,3,3-trimethylindol-1-ium-5-yl]-2-sulfanylacetamide |
| SMILES | CC(O)CN(CC(C)O)c1ccc(/C=C/C2=[N+](C)c3ccc(NC(=O)CS)cc3C2(C)C)cc1 |
| InChI | InChI=1S/C27H35N3O3S/c1-18(31)15-30(16-19(2)32)22-10-6-20(7-11-22)8-13-25-27(3,4)23-14-21(28-26(33)17-34)9-12-24(23)29(25)5/h6-14,18-19,31-32H,15-17H2,1-5H3,(H-,28,33,34)/p+1 |
| InChIKey | UXKXLEHCQDHLPH-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 75.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|