About 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde
9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde (PubChem CID 89199923) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde |
| PubChem CID | 89199923 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde |
| SMILES | CCn1c2c(c3cc(C=O)ccc31)C=CCC2 |
| InChI | InChI=1S/C15H15NO/c1-2-16-14-6-4-3-5-12(14)13-9-11(10-17)7-8-15(13)16/h3,5,7-10H,2,4,6H2,1H3 |
| InChIKey | AAFDZCUYXUFPIA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde?
The IUPAC name of 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde (CID 89199923) is 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde.
What is the SMILES notation for 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde?
The canonical SMILES for 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde is CCn1c2c(c3cc(C=O)ccc31)C=CCC2.
What is the InChIKey of 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde?
The InChIKey is AAFDZCUYXUFPIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c1-2-16-14-6-4-3-5-12(14)13-9-11(10-17)7-8-15(13)16/h3,5,7-10H,2,4,6H2,1H3.
What are the key properties of 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde?
9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde has a molecular weight of 225.29 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-7,8-dihydrocarbazole-3-carbaldehyde is sourced from PubChem (CID 89199923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).