C23H19ClN6O — CID 89200013
N-[(3-chlorophenyl)methyl]-4-[(3Z)-4-imino-3-[methoxy(pyrimidin-4-yl)methylidene]cyclohexa-1,5-dien-1-yl]pyrimidin-2-amine (PubChem CID 89200013) has the molecular formula C23H19ClN6O and a molecular weight of 430.90 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-[(3Z)-4-imino-3-[methoxy(pyrimidin-4-yl)methylidene]cyclohexa-1,5-dien-1-yl]pyrimidin-2-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-[(3Z)-4-imino-3-[methoxy(pyrimidin-4-yl)methylidene]cyclohexa-1,5-dien-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89200013 |
| Molecular Formula | C23H19ClN6O |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-[(3Z)-4-imino-3-[methoxy(pyrimidin-4-yl)methylidene]cyclohexa-1,5-dien-1-yl]pyrimidin-2-amine |
| SMILES | [H]/N=C1\C=CC(c2ccnc(NCc3cccc(Cl)c3)n2)=C\C1=C(\OC)c1ccncn1 |
| InChI | InChI=1S/C23H19ClN6O/c1-31-22(21-7-9-26-14-29-21)18-12-16(5-6-19(18)25)20-8-10-27-23(30-20)28-13-15-3-2-4-17(24)11-15/h2-12,14,25H,13H2,1H3,(H,27,28,30)/b22-18-,25-19+ |
| InChIKey | JIQBGYDJFCAYHZ-RRLBNYLJSA-N |
| XLogP | 4.56 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|