About (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine
(5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine (PubChem CID 89200020) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine.
Molecular Properties
| Compound Name | (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine |
| PubChem CID | 89200020 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine |
| SMILES | C=C/C=C1/CCC=N/C1=C/C |
| InChI | InChI=1S/C10H13N/c1-3-6-9-7-5-8-11-10(9)4-2/h3-4,6,8H,1,5,7H2,2H3/b9-6-,10-4+ |
| InChIKey | YZPZZZDYZAZSIS-WFNCLBMMSA-N |
| XLogP | 2.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine?
The IUPAC name of (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine (CID 89200020) is (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine.
What is the SMILES notation for (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine?
The canonical SMILES for (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine is C=C/C=C1/CCC=N/C1=C/C.
What is the InChIKey of (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine?
The InChIKey is YZPZZZDYZAZSIS-WFNCLBMMSA-N. The full InChI is InChI=1S/C10H13N/c1-3-6-9-7-5-8-11-10(9)4-2/h3-4,6,8H,1,5,7H2,2H3/b9-6-,10-4+.
What are the key properties of (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine?
(5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine has a molecular weight of 147.22 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6E)-6-ethylidene-5-prop-2-enylidene-3,4-dihydropyridine is sourced from PubChem (CID 89200020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).