C28H24F2N6O2 — CID 89200072
N-[[4-[(4-aminophenyl)methyl]-1,2,4-triazol-3-yl]methyl]-N-[(2,4-difluorophenyl)methyl]-4-methoxyquinoline-2-carboxamide (PubChem CID 89200072) has the molecular formula C28H24F2N6O2 and a molecular weight of 514.54 g/mol. Its IUPAC name is N-[[4-[(4-aminophenyl)methyl]-1,2,4-triazol-3-yl]methyl]-N-[(2,4-difluorophenyl)methyl]-4-methoxyquinoline-2-carboxamide.
| Compound Name | N-[[4-[(4-aminophenyl)methyl]-1,2,4-triazol-3-yl]methyl]-N-[(2,4-difluorophenyl)methyl]-4-methoxyquinoline-2-carboxamide |
|---|---|
| PubChem CID | 89200072 |
| Molecular Formula | C28H24F2N6O2 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-[[4-[(4-aminophenyl)methyl]-1,2,4-triazol-3-yl]methyl]-N-[(2,4-difluorophenyl)methyl]-4-methoxyquinoline-2-carboxamide |
| SMILES | COc1cc(C(=O)N(Cc2ccc(F)cc2F)Cc2nncn2Cc2ccc(N)cc2)nc2ccccc12 |
| InChI | InChI=1S/C28H24F2N6O2/c1-38-26-13-25(33-24-5-3-2-4-22(24)26)28(37)35(15-19-8-9-20(29)12-23(19)30)16-27-34-32-17-36(27)14-18-6-10-21(31)11-7-18/h2-13,17H,14-16,31H2,1H3 |
| InChIKey | WZCRUAIPVPTYAV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|