About 3-ethyl-N-methyl-1,3-oxazolidin-2-imine
3-ethyl-N-methyl-1,3-oxazolidin-2-imine (PubChem CID 89200308) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-ethyl-N-methyl-1,3-oxazolidin-2-imine.
Molecular Properties
| Compound Name | 3-ethyl-N-methyl-1,3-oxazolidin-2-imine |
| PubChem CID | 89200308 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 3-ethyl-N-methyl-1,3-oxazolidin-2-imine |
| SMILES | CCN1CCO/C1=N\C |
| InChI | InChI=1S/C6H12N2O/c1-3-8-4-5-9-6(8)7-2/h3-5H2,1-2H3/b7-6- |
| InChIKey | SOBUOULIHKTPEU-SREVYHEPSA-N |
| XLogP | 0.32 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N-methyl-1,3-oxazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-methyl-1,3-oxazolidin-2-imine?
The IUPAC name of 3-ethyl-N-methyl-1,3-oxazolidin-2-imine (CID 89200308) is 3-ethyl-N-methyl-1,3-oxazolidin-2-imine.
What is the SMILES notation for 3-ethyl-N-methyl-1,3-oxazolidin-2-imine?
The canonical SMILES for 3-ethyl-N-methyl-1,3-oxazolidin-2-imine is CCN1CCO/C1=N\C.
What is the InChIKey of 3-ethyl-N-methyl-1,3-oxazolidin-2-imine?
The InChIKey is SOBUOULIHKTPEU-SREVYHEPSA-N. The full InChI is InChI=1S/C6H12N2O/c1-3-8-4-5-9-6(8)7-2/h3-5H2,1-2H3/b7-6-.
What are the key properties of 3-ethyl-N-methyl-1,3-oxazolidin-2-imine?
3-ethyl-N-methyl-1,3-oxazolidin-2-imine has a molecular weight of 128.17 g/mol, XLogP of 0.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-methyl-1,3-oxazolidin-2-imine is sourced from PubChem (CID 89200308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).