C19H30O4 — CID 89200555
2-(2-ethoxyethoxy)-6-[(1E,3E)-4-(2-ethoxyethoxy)penta-1,3-dienyl]cyclohexa-1,3-diene (PubChem CID 89200555) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-6-[(1E,3E)-4-(2-ethoxyethoxy)penta-1,3-dienyl]cyclohexa-1,3-diene.
| Compound Name | 2-(2-ethoxyethoxy)-6-[(1E,3E)-4-(2-ethoxyethoxy)penta-1,3-dienyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89200555 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-(2-ethoxyethoxy)-6-[(1E,3E)-4-(2-ethoxyethoxy)penta-1,3-dienyl]cyclohexa-1,3-diene |
| SMILES | CCOCCOC1=CC(/C=C/C=C(\C)OCCOCC)CC=C1 |
| InChI | InChI=1S/C19H30O4/c1-4-20-12-14-22-17(3)8-6-9-18-10-7-11-19(16-18)23-15-13-21-5-2/h6-9,11,16,18H,4-5,10,12-15H2,1-3H3/b9-6+,17-8+ |
| InChIKey | ACZJKGROMIHNFA-LQWOVWEESA-N |
| XLogP | 4.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|