C20H26FNO3 — CID 89200791
9-(2-fluoroethyl)-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carboxylic acid (PubChem CID 89200791) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is 9-(2-fluoroethyl)-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-(2-fluoroethyl)-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 89200791 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 9-(2-fluoroethyl)-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C1CC(C3CCOCC3)CCC1N2CCF |
| InChI | InChI=1S/C20H26FNO3/c21-7-8-22-18-3-1-14(13-5-9-25-10-6-13)11-16(18)17-12-15(20(23)24)2-4-19(17)22/h2,4,12-14,16,18H,1,3,5-11H2,(H,23,24) |
| InChIKey | CYCPGAHFSZZWSP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |