About 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine
2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine (PubChem CID 89200794) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine |
| PubChem CID | 89200794 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine |
| SMILES | NC1CNc2cccnc21 |
| InChI | InChI=1S/C7H9N3/c8-5-4-10-6-2-1-3-9-7(5)6/h1-3,5,10H,4,8H2 |
| InChIKey | NFBJZEJAWJPXSB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine?
The IUPAC name of 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine (CID 89200794) is 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine.
What is the SMILES notation for 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine?
The canonical SMILES for 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine is NC1CNc2cccnc21.
What is the InChIKey of 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine?
The InChIKey is NFBJZEJAWJPXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c8-5-4-10-6-2-1-3-9-7(5)6/h1-3,5,10H,4,8H2.
What are the key properties of 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine?
2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine has a molecular weight of 135.17 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrrolo[3,2-b]pyridin-3-amine is sourced from PubChem (CID 89200794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).