C13H16O3S — CID 89201076
(1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-1,3a,5,7,8,8a,9,9a-octahydrothiopyrano[4,3-f][2]benzofuran-9-carbaldehyde (PubChem CID 89201076) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-1,3a,5,7,8,8a,9,9a-octahydrothiopyrano[4,3-f][2]benzofuran-9-carbaldehyde.
| Compound Name | (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-1,3a,5,7,8,8a,9,9a-octahydrothiopyrano[4,3-f][2]benzofuran-9-carbaldehyde |
|---|---|
| PubChem CID | 89201076 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-1,3a,5,7,8,8a,9,9a-octahydrothiopyrano[4,3-f][2]benzofuran-9-carbaldehyde |
| SMILES | C[C@H]1OC(=O)[C@@H]2C=C3CSCC[C@H]3[C@H](C=O)[C@H]12 |
| InChI | InChI=1S/C13H16O3S/c1-7-12-10(13(15)16-7)4-8-6-17-3-2-9(8)11(12)5-14/h4-5,7,9-12H,2-3,6H2,1H3/t7-,9-,10-,11+,12-/m1/s1 |
| InChIKey | JJQMYNLWMPBBHR-BVNKDQMESA-N |
| XLogP | 1.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|