About 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate
2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate (PubChem CID 89201162) has the molecular formula C8H12INO2
and a molecular weight of 281.09 g/mol. Its IUPAC name is 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate |
| PubChem CID | 89201162 |
| Molecular Formula | C8H12INO2 |
| Molecular Weight | 281.09 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate |
| SMILES | CCC(C)(C)OC(=O)[C@@H](I)C#N |
| InChI | InChI=1S/C8H12INO2/c1-4-8(2,3)12-7(11)6(9)5-10/h6H,4H2,1-3H3/t6-/m0/s1 |
| InChIKey | LCSUTBDKSJCWND-LURJTMIESA-N |
| XLogP | 2.05 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.09 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate?
The IUPAC name of 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate (CID 89201162) is 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate.
What is the SMILES notation for 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate?
The canonical SMILES for 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate is CCC(C)(C)OC(=O)[C@@H](I)C#N.
What is the InChIKey of 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate?
The InChIKey is LCSUTBDKSJCWND-LURJTMIESA-N. The full InChI is InChI=1S/C8H12INO2/c1-4-8(2,3)12-7(11)6(9)5-10/h6H,4H2,1-3H3/t6-/m0/s1.
What are the key properties of 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate?
2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate has a molecular weight of 281.09 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl (2S)-2-cyano-2-iodoacetate is sourced from PubChem (CID 89201162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).