C15H23BN2O3 — CID 89201384
4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-ethyl-1-(oxan-2-yl)pyrazole (PubChem CID 89201384) has the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. Its IUPAC name is 4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-ethyl-1-(oxan-2-yl)pyrazole.
| Compound Name | 4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-ethyl-1-(oxan-2-yl)pyrazole |
|---|---|
| PubChem CID | 89201384 |
| Molecular Formula | C15H23BN2O3 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-3-ethyl-1-(oxan-2-yl)pyrazole |
| SMILES | C=C1OB(c2cn(C3CCCCO3)nc2CC)OC1(C)C |
| InChI | InChI=1S/C15H23BN2O3/c1-5-13-12(16-20-11(2)15(3,4)21-16)10-18(17-13)14-8-6-7-9-19-14/h10,14H,2,5-9H2,1,3-4H3 |
| InChIKey | CYPMZCIAQFHCJS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|