About (3S)-3-amino-2,7,7-trimethyloctan-4-one
(3S)-3-amino-2,7,7-trimethyloctan-4-one (PubChem CID 89201643) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is (3S)-3-amino-2,7,7-trimethyloctan-4-one.
Molecular Properties
| Compound Name | (3S)-3-amino-2,7,7-trimethyloctan-4-one |
| PubChem CID | 89201643 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (3S)-3-amino-2,7,7-trimethyloctan-4-one |
| SMILES | CC(C)[C@H](N)C(=O)CCC(C)(C)C |
| InChI | InChI=1S/C11H23NO/c1-8(2)10(12)9(13)6-7-11(3,4)5/h8,10H,6-7,12H2,1-5H3/t10-/m0/s1 |
| InChIKey | UDJUSIBWTWQQCM-JTQLQIEISA-N |
| XLogP | 2.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-amino-2,7,7-trimethyloctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-2,7,7-trimethyloctan-4-one?
The IUPAC name of (3S)-3-amino-2,7,7-trimethyloctan-4-one (CID 89201643) is (3S)-3-amino-2,7,7-trimethyloctan-4-one.
What is the SMILES notation for (3S)-3-amino-2,7,7-trimethyloctan-4-one?
The canonical SMILES for (3S)-3-amino-2,7,7-trimethyloctan-4-one is CC(C)[C@H](N)C(=O)CCC(C)(C)C.
What is the InChIKey of (3S)-3-amino-2,7,7-trimethyloctan-4-one?
The InChIKey is UDJUSIBWTWQQCM-JTQLQIEISA-N. The full InChI is InChI=1S/C11H23NO/c1-8(2)10(12)9(13)6-7-11(3,4)5/h8,10H,6-7,12H2,1-5H3/t10-/m0/s1.
What are the key properties of (3S)-3-amino-2,7,7-trimethyloctan-4-one?
(3S)-3-amino-2,7,7-trimethyloctan-4-one has a molecular weight of 185.31 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-2,7,7-trimethyloctan-4-one is sourced from PubChem (CID 89201643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).