C20H27FN2O5 — CID 89202036
benzyl N-[(2S)-1-[(1-fluoro-2,6-dioxohexan-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 89202036) has the molecular formula C20H27FN2O5 and a molecular weight of 394.44 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(1-fluoro-2,6-dioxohexan-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(1-fluoro-2,6-dioxohexan-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 89202036 |
| Molecular Formula | C20H27FN2O5 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | benzyl N-[(2S)-1-[(1-fluoro-2,6-dioxohexan-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NC(CCC=O)C(=O)CF |
| InChI | InChI=1S/C20H27FN2O5/c1-14(2)11-17(19(26)22-16(9-6-10-24)18(25)12-21)23-20(27)28-13-15-7-4-3-5-8-15/h3-5,7-8,10,14,16-17H,6,9,11-13H2,1-2H3,(H,22,26)(H,23,27)/t16?,17-/m0/s1 |
| InChIKey | LGBMKYNJNLRYFE-DJNXLDHESA-N |
| XLogP | 2.33 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|