C17H33N — CID 89202149
(4Z,6Z)-N,7-dipropylundeca-4,6-dien-6-amine (PubChem CID 89202149) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is (4Z,6Z)-N,7-dipropylundeca-4,6-dien-6-amine.
| Compound Name | (4Z,6Z)-N,7-dipropylundeca-4,6-dien-6-amine |
|---|---|
| PubChem CID | 89202149 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | (4Z,6Z)-N,7-dipropylundeca-4,6-dien-6-amine |
| SMILES | CCC/C=C\C(NCCC)=C(/CCC)CCCC |
| InChI | InChI=1S/C17H33N/c1-5-9-11-14-17(18-15-8-4)16(12-7-3)13-10-6-2/h11,14,18H,5-10,12-13,15H2,1-4H3/b14-11-,17-16- |
| InChIKey | XLXOAVBWOSZHQZ-SJKKTQPASA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|