C42H43N4O2S2+ — CID 89202310
phenyl (E)-N-methyl-3-[2-methyl-1-[2-[2-[2-methyl-3-[(E)-2-(3-methyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-6,7-dihydroindol-1-yl]ethyldisulfanyl]ethyl]indol-3-yl]prop-2-enimidate (PubChem CID 89202310) has the molecular formula C42H43N4O2S2+ and a molecular weight of 699.97 g/mol. Its IUPAC name is phenyl (E)-N-methyl-3-[2-methyl-1-[2-[2-[2-methyl-3-[(E)-2-(3-methyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-6,7-dihydroindol-1-yl]ethyldisulfanyl]ethyl]indol-3-yl]prop-2-enimidate.
| Compound Name | phenyl (E)-N-methyl-3-[2-methyl-1-[2-[2-[2-methyl-3-[(E)-2-(3-methyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-6,7-dihydroindol-1-yl]ethyldisulfanyl]ethyl]indol-3-yl]prop-2-enimidate |
|---|---|
| PubChem CID | 89202310 |
| Molecular Formula | C42H43N4O2S2+ |
| Molecular Weight | 699.97 g/mol |
| Exact Mass | 699.28 |
| IUPAC Name | phenyl (E)-N-methyl-3-[2-methyl-1-[2-[2-[2-methyl-3-[(E)-2-(3-methyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-6,7-dihydroindol-1-yl]ethyldisulfanyl]ethyl]indol-3-yl]prop-2-enimidate |
| SMILES | C/N=C(\C=C\c1c(C)n(CCSSCCn2c(C)c(/C=C/c3oc4ccccc4[n+]3C)c3c2CCC=C3)c2ccccc12)Oc1ccccc1 |
| InChI | InChI=1S/C42H43N4O2S2/c1-30-33(22-24-41(43-3)47-32-14-6-5-7-15-32)35-16-8-10-18-37(35)45(30)26-28-49-50-29-27-46-31(2)34(36-17-9-11-19-38(36)46)23-25-42-44(4)39-20-12-13-21-40(39)48-42/h5-10,12-18,20-25H,11,19,26-29H2,1-4H3/q+1/b24-22+,43-41+ |
| InChIKey | FWVVXWKJSPZWDJ-GPOOZHQZSA-N |
| XLogP | 9.96 |
| TPSA | 48.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.97 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|