C22H32F4O — CID 89202331
1-[(2E,4E,6E)-6-fluoro-5-(trifluoromethoxy)octa-2,4,6-trien-2-yl]-4-(4-methylcyclohexyl)cyclohexane (PubChem CID 89202331) has the molecular formula C22H32F4O and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[(2E,4E,6E)-6-fluoro-5-(trifluoromethoxy)octa-2,4,6-trien-2-yl]-4-(4-methylcyclohexyl)cyclohexane.
| Compound Name | 1-[(2E,4E,6E)-6-fluoro-5-(trifluoromethoxy)octa-2,4,6-trien-2-yl]-4-(4-methylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 89202331 |
| Molecular Formula | C22H32F4O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-[(2E,4E,6E)-6-fluoro-5-(trifluoromethoxy)octa-2,4,6-trien-2-yl]-4-(4-methylcyclohexyl)cyclohexane |
| SMILES | C/C=C(F)\C(=C/C=C(\C)C1CCC(C2CCC(C)CC2)CC1)OC(F)(F)F |
| InChI | InChI=1S/C22H32F4O/c1-4-20(23)21(27-22(24,25)26)14-7-16(3)17-10-12-19(13-11-17)18-8-5-15(2)6-9-18/h4,7,14-15,17-19H,5-6,8-13H2,1-3H3/b16-7+,20-4+,21-14+ |
| InChIKey | VWSSWNICYYXTFU-KOTZPITJSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|