C26H27ClO5 — CID 89202386
(1S,2S,3S)-1-chloro-3-(3,5-dimethoxyphenyl)-4,6-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydro-1H-indene (PubChem CID 89202386) has the molecular formula C26H27ClO5 and a molecular weight of 454.95 g/mol. Its IUPAC name is (1S,2S,3S)-1-chloro-3-(3,5-dimethoxyphenyl)-4,6-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydro-1H-indene.
| Compound Name | (1S,2S,3S)-1-chloro-3-(3,5-dimethoxyphenyl)-4,6-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 89202386 |
| Molecular Formula | C26H27ClO5 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (1S,2S,3S)-1-chloro-3-(3,5-dimethoxyphenyl)-4,6-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydro-1H-indene |
| SMILES | COc1ccc([C@@H]2[C@@H](c3cc(OC)cc(OC)c3)c3c(OC)cc(OC)cc3[C@H]2Cl)cc1 |
| InChI | InChI=1S/C26H27ClO5/c1-28-17-8-6-15(7-9-17)24-23(16-10-18(29-2)12-19(11-16)30-3)25-21(26(24)27)13-20(31-4)14-22(25)32-5/h6-14,23-24,26H,1-5H3/t23-,24-,26-/m1/s1 |
| InChIKey | ANHLTGMCOBMZKI-DGWZTRNLSA-N |
| XLogP | 5.94 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|