C18H22N10O2S — CID 89202688
2,6-bis(2-methoxyethylamino)-4-methyl-5-[[1-(1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]diazenyl]pyridine-3-carbonitrile (PubChem CID 89202688) has the molecular formula C18H22N10O2S and a molecular weight of 442.51 g/mol. Its IUPAC name is 2,6-bis(2-methoxyethylamino)-4-methyl-5-[[1-(1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]diazenyl]pyridine-3-carbonitrile.
| Compound Name | 2,6-bis(2-methoxyethylamino)-4-methyl-5-[[1-(1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]diazenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 89202688 |
| Molecular Formula | C18H22N10O2S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2,6-bis(2-methoxyethylamino)-4-methyl-5-[[1-(1,3-thiazol-2-yl)-1,2,4-triazol-3-yl]diazenyl]pyridine-3-carbonitrile |
| SMILES | COCCNc1nc(NCCOC)c(/N=N/c2ncn(-c3nccs3)n2)c(C)c1C#N |
| InChI | InChI=1S/C18H22N10O2S/c1-12-13(10-19)15(20-4-7-29-2)24-16(21-5-8-30-3)14(12)25-26-17-23-11-28(27-17)18-22-6-9-31-18/h6,9,11H,4-5,7-8H2,1-3H3,(H2,20,21,24)/b26-25+ |
| InChIKey | KRTCFSULWHYZLP-OCEACIFDSA-N |
| XLogP | 2.83 |
| TPSA | 147.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|