C26H38N2O — CID 89202745
(2E,3Z,6E,8Z)-N-[(Z)-7-amino-4-ethyl-3-methylidenehept-6-enyl]-6-ethenyl-2-ethylidene-3-methyl-5-methylidenedeca-3,6,8-trienamide (PubChem CID 89202745) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is (2E,3Z,6E,8Z)-N-[(Z)-7-amino-4-ethyl-3-methylidenehept-6-enyl]-6-ethenyl-2-ethylidene-3-methyl-5-methylidenedeca-3,6,8-trienamide.
| Compound Name | (2E,3Z,6E,8Z)-N-[(Z)-7-amino-4-ethyl-3-methylidenehept-6-enyl]-6-ethenyl-2-ethylidene-3-methyl-5-methylidenedeca-3,6,8-trienamide |
|---|---|
| PubChem CID | 89202745 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | (2E,3Z,6E,8Z)-N-[(Z)-7-amino-4-ethyl-3-methylidenehept-6-enyl]-6-ethenyl-2-ethylidene-3-methyl-5-methylidenedeca-3,6,8-trienamide |
| SMILES | C=C/C(=C\C=C/C)C(=C)/C=C(C)\C(=C/C)C(=O)NCCC(=C)C(CC)C/C=C\N |
| InChI | InChI=1S/C26H38N2O/c1-8-12-14-24(10-3)21(6)19-22(7)25(11-4)26(29)28-18-16-20(5)23(9-2)15-13-17-27/h8,10-14,17,19,23H,3,5-6,9,15-16,18,27H2,1-2,4,7H3,(H,28,29)/b12-8-,17-13-,22-19-,24-14+,25-11+ |
| InChIKey | ZRIKNVQWFWUIAV-CYPMZWQKSA-N |
| XLogP | 6.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|