About 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole
6-fluoro-1-methyl-2,3,6,7-tetrahydroindole (PubChem CID 89202987) has the molecular formula C9H12FN
and a molecular weight of 153.20 g/mol. Its IUPAC name is 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole.
Molecular Properties
| Compound Name | 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole |
| PubChem CID | 89202987 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole |
| SMILES | CN1CCC2=C1CC(F)C=C2 |
| InChI | InChI=1S/C9H12FN/c1-11-5-4-7-2-3-8(10)6-9(7)11/h2-3,8H,4-6H2,1H3 |
| InChIKey | CKFVUIBYFTXQLE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole?
The IUPAC name of 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole (CID 89202987) is 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole.
What is the SMILES notation for 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole?
The canonical SMILES for 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole is CN1CCC2=C1CC(F)C=C2.
What is the InChIKey of 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole?
The InChIKey is CKFVUIBYFTXQLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN/c1-11-5-4-7-2-3-8(10)6-9(7)11/h2-3,8H,4-6H2,1H3.
What are the key properties of 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole?
6-fluoro-1-methyl-2,3,6,7-tetrahydroindole has a molecular weight of 153.20 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-methyl-2,3,6,7-tetrahydroindole is sourced from PubChem (CID 89202987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).