C20H21NO — CID 89203299
(Z)-1-[4-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)phenyl]but-2-en-1-one (PubChem CID 89203299) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (Z)-1-[4-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)phenyl]but-2-en-1-one.
| Compound Name | (Z)-1-[4-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 89203299 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (Z)-1-[4-(4-amino-5,6,7,8-tetrahydronaphthalen-1-yl)phenyl]but-2-en-1-one |
| SMILES | C/C=C\C(=O)c1ccc(-c2ccc(N)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C20H21NO/c1-2-5-20(22)15-10-8-14(9-11-15)16-12-13-19(21)18-7-4-3-6-17(16)18/h2,5,8-13H,3-4,6-7,21H2,1H3/b5-2- |
| InChIKey | LHLJBGCPTYYWLM-DJWKRKHSSA-N |
| XLogP | 4.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|