C23H25N3O4 — CID 8920331
N-(4-ethoxyphenyl)-2-[[2-[[(1S)-1-(furan-2-yl)ethyl]amino]acetyl]amino]benzamide (PubChem CID 8920331) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[2-[[(1S)-1-(furan-2-yl)ethyl]amino]acetyl]amino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[2-[[(1S)-1-(furan-2-yl)ethyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8920331 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[2-[[(1S)-1-(furan-2-yl)ethyl]amino]acetyl]amino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=O)CN[C@@H](C)c2ccco2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-3-29-18-12-10-17(11-13-18)25-23(28)19-7-4-5-8-20(19)26-22(27)15-24-16(2)21-9-6-14-30-21/h4-14,16,24H,3,15H2,1-2H3,(H,25,28)(H,26,27)/t16-/m0/s1 |
| InChIKey | POFFDEKLVIOTQW-INIZCTEOSA-N |
| XLogP | 4.22 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |