About (E)-3-methylbut-1-ene-1,2-diamine
(E)-3-methylbut-1-ene-1,2-diamine (PubChem CID 89203497) has the molecular formula C5H12N2
and a molecular weight of 100.16 g/mol. Its IUPAC name is (E)-3-methylbut-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-3-methylbut-1-ene-1,2-diamine |
| PubChem CID | 89203497 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | (E)-3-methylbut-1-ene-1,2-diamine |
| SMILES | CC(C)/C(N)=C\N |
| InChI | InChI=1S/C5H12N2/c1-4(2)5(7)3-6/h3-4H,6-7H2,1-2H3/b5-3+ |
| InChIKey | HUNSHXGWGKJJKD-HWKANZROSA-N |
| XLogP | 0.40 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-3-methylbut-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methylbut-1-ene-1,2-diamine?
The IUPAC name of (E)-3-methylbut-1-ene-1,2-diamine (CID 89203497) is (E)-3-methylbut-1-ene-1,2-diamine.
What is the SMILES notation for (E)-3-methylbut-1-ene-1,2-diamine?
The canonical SMILES for (E)-3-methylbut-1-ene-1,2-diamine is CC(C)/C(N)=C\N.
What is the InChIKey of (E)-3-methylbut-1-ene-1,2-diamine?
The InChIKey is HUNSHXGWGKJJKD-HWKANZROSA-N. The full InChI is InChI=1S/C5H12N2/c1-4(2)5(7)3-6/h3-4H,6-7H2,1-2H3/b5-3+.
What are the key properties of (E)-3-methylbut-1-ene-1,2-diamine?
(E)-3-methylbut-1-ene-1,2-diamine has a molecular weight of 100.16 g/mol, XLogP of 0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methylbut-1-ene-1,2-diamine is sourced from PubChem (CID 89203497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).