C54H48Br3N3 — CID 89203500
2,4,6-tris(7-bromo-9,9-diethylfluoren-2-yl)-1,3,5-triazine (PubChem CID 89203500) has the molecular formula C54H48Br3N3 and a molecular weight of 978.71 g/mol. Its IUPAC name is 2,4,6-tris(7-bromo-9,9-diethylfluoren-2-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(7-bromo-9,9-diethylfluoren-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 89203500 |
| Molecular Formula | C54H48Br3N3 |
| Molecular Weight | 978.71 g/mol |
| Exact Mass | 975.14 |
| IUPAC Name | 2,4,6-tris(7-bromo-9,9-diethylfluoren-2-yl)-1,3,5-triazine |
| SMILES | CCC1(CC)c2cc(Br)ccc2-c2ccc(-c3nc(-c4ccc5c(c4)C(CC)(CC)c4cc(Br)ccc4-5)nc(-c4ccc5c(c4)C(CC)(CC)c4cc(Br)ccc4-5)n3)cc21 |
| InChI | InChI=1S/C54H48Br3N3/c1-7-52(8-2)43-25-31(13-19-37(43)40-22-16-34(55)28-46(40)52)49-58-50(32-14-20-38-41-23-17-35(56)29-47(41)53(9-3,10-4)44(38)26-32)60-51(59-49)33-15-21-39-42-24-18-36(57)30-48(42)54(11-5,12-6)45(39)27-33/h13-30H,7-12H2,1-6H3 |
| InChIKey | AGMADTFSCJTQGX-UHFFFAOYSA-N |
| XLogP | 16.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.71 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |