About (3R)-4-(chloromethyl)-3,5-difluorocyclohexene
(3R)-4-(chloromethyl)-3,5-difluorocyclohexene (PubChem CID 89203561) has the molecular formula C7H9ClF2
and a molecular weight of 166.60 g/mol. Its IUPAC name is (3R)-4-(chloromethyl)-3,5-difluorocyclohexene.
Molecular Properties
| Compound Name | (3R)-4-(chloromethyl)-3,5-difluorocyclohexene |
| PubChem CID | 89203561 |
| Molecular Formula | C7H9ClF2 |
| Molecular Weight | 166.60 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | (3R)-4-(chloromethyl)-3,5-difluorocyclohexene |
| SMILES | FC1CC=C[C@@H](F)C1CCl |
| InChI | InChI=1S/C7H9ClF2/c8-4-5-6(9)2-1-3-7(5)10/h1-2,5-7H,3-4H2/t5?,6-,7?/m1/s1 |
| InChIKey | NHTVMOHMMQCZRV-YURFNIAASA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4-(chloromethyl)-3,5-difluorocyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-(chloromethyl)-3,5-difluorocyclohexene?
The IUPAC name of (3R)-4-(chloromethyl)-3,5-difluorocyclohexene (CID 89203561) is (3R)-4-(chloromethyl)-3,5-difluorocyclohexene.
What is the SMILES notation for (3R)-4-(chloromethyl)-3,5-difluorocyclohexene?
The canonical SMILES for (3R)-4-(chloromethyl)-3,5-difluorocyclohexene is FC1CC=C[C@@H](F)C1CCl.
What is the InChIKey of (3R)-4-(chloromethyl)-3,5-difluorocyclohexene?
The InChIKey is NHTVMOHMMQCZRV-YURFNIAASA-N. The full InChI is InChI=1S/C7H9ClF2/c8-4-5-6(9)2-1-3-7(5)10/h1-2,5-7H,3-4H2/t5?,6-,7?/m1/s1.
What are the key properties of (3R)-4-(chloromethyl)-3,5-difluorocyclohexene?
(3R)-4-(chloromethyl)-3,5-difluorocyclohexene has a molecular weight of 166.60 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-(chloromethyl)-3,5-difluorocyclohexene is sourced from PubChem (CID 89203561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).