C32H51NO2 — CID 89203715
(3E,5E,9S)-1-[6-(2-amino-4-methoxy-3-methylbutyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3,6,9-trimethyltrideca-3,5-dien-2-one (PubChem CID 89203715) has the molecular formula C32H51NO2 and a molecular weight of 481.77 g/mol. Its IUPAC name is (3E,5E,9S)-1-[6-(2-amino-4-methoxy-3-methylbutyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3,6,9-trimethyltrideca-3,5-dien-2-one.
| Compound Name | (3E,5E,9S)-1-[6-(2-amino-4-methoxy-3-methylbutyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3,6,9-trimethyltrideca-3,5-dien-2-one |
|---|---|
| PubChem CID | 89203715 |
| Molecular Formula | C32H51NO2 |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 481.39 |
| IUPAC Name | (3E,5E,9S)-1-[6-(2-amino-4-methoxy-3-methylbutyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-3,6,9-trimethyltrideca-3,5-dien-2-one |
| SMILES | CCCC[C@H](C)CC/C(C)=C/C=C(\C)C(=O)CC1CCc2cc(CC(N)C(C)COC)ccc2C1 |
| InChI | InChI=1S/C32H51NO2/c1-7-8-9-23(2)10-11-24(3)12-13-25(4)32(34)21-28-15-17-29-18-27(14-16-30(29)19-28)20-31(33)26(5)22-35-6/h12-14,16,18,23,26,28,31H,7-11,15,17,19-22,33H2,1-6H3/b24-12+,25-13+/t23-,26?,28?,31?/m0/s1 |
| InChIKey | OZOLYVOTFICNRR-JYXLGJMLSA-N |
| XLogP | 7.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|