C15H17ClN4OS — CID 89203868
(Z)-2-aminosulfanyl-N-[(2-chloro-6-cyanophenyl)methyl]-3-cyclopropyl-3-(methylamino)prop-2-enamide (PubChem CID 89203868) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is (Z)-2-aminosulfanyl-N-[(2-chloro-6-cyanophenyl)methyl]-3-cyclopropyl-3-(methylamino)prop-2-enamide.
| Compound Name | (Z)-2-aminosulfanyl-N-[(2-chloro-6-cyanophenyl)methyl]-3-cyclopropyl-3-(methylamino)prop-2-enamide |
|---|---|
| PubChem CID | 89203868 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (Z)-2-aminosulfanyl-N-[(2-chloro-6-cyanophenyl)methyl]-3-cyclopropyl-3-(methylamino)prop-2-enamide |
| SMILES | CN/C(=C(\SN)C(=O)NCc1c(Cl)cccc1C#N)C1CC1 |
| InChI | InChI=1S/C15H17ClN4OS/c1-19-13(9-5-6-9)14(22-18)15(21)20-8-11-10(7-17)3-2-4-12(11)16/h2-4,9,19H,5-6,8,18H2,1H3,(H,20,21)/b14-13- |
| InChIKey | DZZFKLPPETWRJM-YPKPFQOOSA-N |
| XLogP | 2.28 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|