C26H30N2O3 — CID 89204003
3-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-5-formyl-1,3,5-trimethylcyclohexane-1-carboxamide (PubChem CID 89204003) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-5-formyl-1,3,5-trimethylcyclohexane-1-carboxamide.
| Compound Name | 3-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-5-formyl-1,3,5-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 89204003 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 3-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-5-formyl-1,3,5-trimethylcyclohexane-1-carboxamide |
| SMILES | CC1(C=O)CC(C)(C(N)=O)CC(C)(C2=N[C@@H](c3ccccc3)[C@H](c3ccccc3)O2)C1 |
| InChI | InChI=1S/C26H30N2O3/c1-24(17-29)14-25(2,22(27)30)16-26(3,15-24)23-28-20(18-10-6-4-7-11-18)21(31-23)19-12-8-5-9-13-19/h4-13,17,20-21H,14-16H2,1-3H3,(H2,27,30)/t20-,21-,24?,25?,26?/m0/s1 |
| InChIKey | YLICMXLRJYMDMN-QIJXJBLDSA-N |
| XLogP | 4.78 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|