C8H14N2O — CID 89204076
(1Z,3E)-4-methoxy-2-methylhexa-1,3,5-triene-1,5-diamine (PubChem CID 89204076) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (1Z,3E)-4-methoxy-2-methylhexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1Z,3E)-4-methoxy-2-methylhexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 89204076 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (1Z,3E)-4-methoxy-2-methylhexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(N)/C(=C\C(C)=C/N)OC |
| InChI | InChI=1S/C8H14N2O/c1-6(5-9)4-8(11-3)7(2)10/h4-5H,2,9-10H2,1,3H3/b6-5-,8-4+ |
| InChIKey | LHNRYWIKILGVNX-QNMAEOQASA-N |
| XLogP | 0.85 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|