C8H13NO — CID 89204078
(1Z,3E)-4-methoxy-2-methylhexa-1,3,5-trien-1-amine (PubChem CID 89204078) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (1Z,3E)-4-methoxy-2-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-4-methoxy-2-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89204078 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (1Z,3E)-4-methoxy-2-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(=C\C(C)=C/N)OC |
| InChI | InChI=1S/C8H13NO/c1-4-8(10-3)5-7(2)6-9/h4-6H,1,9H2,2-3H3/b7-6-,8-5+ |
| InChIKey | KPIIEAGVMSEVFL-WNXMRAAYSA-N |
| XLogP | 1.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|